C17H19IN2O3 — CID 87450152
3-(butylamino)-5-(iodoamino)-4-phenoxybenzoic acid (PubChem CID 87450152) has the molecular formula C17H19IN2O3 and a molecular weight of 426.25 g/mol. Its IUPAC name is 3-(butylamino)-5-(iodoamino)-4-phenoxybenzoic acid.
| Compound Name | 3-(butylamino)-5-(iodoamino)-4-phenoxybenzoic acid |
|---|---|
| PubChem CID | 87450152 |
| Molecular Formula | C17H19IN2O3 |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 3-(butylamino)-5-(iodoamino)-4-phenoxybenzoic acid |
| SMILES | CCCCNc1cc(C(=O)O)cc(NI)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H19IN2O3/c1-2-3-9-19-14-10-12(17(21)22)11-15(20-18)16(14)23-13-7-5-4-6-8-13/h4-8,10-11,19-20H,2-3,9H2,1H3,(H,21,22) |
| InChIKey | NRUIPODFDYCUOF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|