C16H18N2O6S — CID 21499028
3-(2-methoxyethylamino)-4-phenoxy-5-sulfamoylbenzoic acid (PubChem CID 21499028) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-4-phenoxy-5-sulfamoylbenzoic acid.
| Compound Name | 3-(2-methoxyethylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21499028 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-(2-methoxyethylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| SMILES | COCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C16H18N2O6S/c1-23-8-7-18-13-9-11(16(19)20)10-14(25(17,21)22)15(13)24-12-5-3-2-4-6-12/h2-6,9-10,18H,7-8H2,1H3,(H,19,20)(H2,17,21,22) |
| InChIKey | USFARXKQGNWQSW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|