C17H20N2O5S — CID 59827087
3-(1,1,3,3,4,4,4-heptadeuteriobutylamino)-4-phenoxy-5-sulfamoylbenzoic acid (PubChem CID 59827087) has the molecular formula C17H20N2O5S and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-(1,1,3,3,4,4,4-heptadeuteriobutylamino)-4-phenoxy-5-sulfamoylbenzoic acid.
| Compound Name | 3-(1,1,3,3,4,4,4-heptadeuteriobutylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 59827087 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-(1,1,3,3,4,4,4-heptadeuteriobutylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| SMILES | [2H]C([2H])(CC([2H])([2H])C([2H])([2H])[2H])Nc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13/h4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23)/i1D3,2D2,9D2 |
| InChIKey | MAEIEVLCKWDQJH-TXFBWYMTSA-N |
| XLogP | 3.04 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |