C25H22N2O5S — CID 15052108
3-(2-naphthalen-1-ylethylamino)-4-phenoxy-5-sulfamoylbenzoic acid (PubChem CID 15052108) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is 3-(2-naphthalen-1-ylethylamino)-4-phenoxy-5-sulfamoylbenzoic acid.
| Compound Name | 3-(2-naphthalen-1-ylethylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 15052108 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 3-(2-naphthalen-1-ylethylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(NCCc2cccc3ccccc23)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H22N2O5S/c26-33(30,31)23-16-19(25(28)29)15-22(24(23)32-20-10-2-1-3-11-20)27-14-13-18-9-6-8-17-7-4-5-12-21(17)18/h1-12,15-16,27H,13-14H2,(H,28,29)(H2,26,30,31) |
| InChIKey | YYLNRRRMFCXHLO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |