C17H18N2O7S — CID 12795716
3-[2-(methoxycarbonylamino)ethyl]-4-phenoxy-5-sulfamoylbenzoic acid (PubChem CID 12795716) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is 3-[2-(methoxycarbonylamino)ethyl]-4-phenoxy-5-sulfamoylbenzoic acid.
| Compound Name | 3-[2-(methoxycarbonylamino)ethyl]-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 12795716 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 3-[2-(methoxycarbonylamino)ethyl]-4-phenoxy-5-sulfamoylbenzoic acid |
| SMILES | COC(=O)NCCc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H18N2O7S/c1-25-17(22)19-8-7-11-9-12(16(20)21)10-14(27(18,23)24)15(11)26-13-5-3-2-4-6-13/h2-6,9-10H,7-8H2,1H3,(H,19,22)(H,20,21)(H2,18,23,24) |
| InChIKey | RITHZGMATIUKSR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |