C18H15NO5S2 — CID 91148335
4-phenoxy-3-sulfamoyl-5-(thiophen-3-ylmethyl)benzoic acid (PubChem CID 91148335) has the molecular formula C18H15NO5S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-phenoxy-3-sulfamoyl-5-(thiophen-3-ylmethyl)benzoic acid.
| Compound Name | 4-phenoxy-3-sulfamoyl-5-(thiophen-3-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 91148335 |
| Molecular Formula | C18H15NO5S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 4-phenoxy-3-sulfamoyl-5-(thiophen-3-ylmethyl)benzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(Cc2ccsc2)c1Oc1ccccc1 |
| InChI | InChI=1S/C18H15NO5S2/c19-26(22,23)16-10-14(18(20)21)9-13(8-12-6-7-25-11-12)17(16)24-15-4-2-1-3-5-15/h1-7,9-11H,8H2,(H,20,21)(H2,19,22,23) |
| InChIKey | CAQUMHHMXVZSHK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |