C30H32N4O10S2 — CID 160510007
3-amino-4-phenoxy-5-sulfamoylbenzoic acid;butyl 3-amino-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 160510007) has the molecular formula C30H32N4O10S2 and a molecular weight of 672.74 g/mol. Its IUPAC name is 3-amino-4-phenoxy-5-sulfamoylbenzoic acid;butyl 3-amino-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | 3-amino-4-phenoxy-5-sulfamoylbenzoic acid;butyl 3-amino-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 160510007 |
| Molecular Formula | C30H32N4O10S2 |
| Molecular Weight | 672.74 g/mol |
| Exact Mass | 672.16 |
| IUPAC Name | 3-amino-4-phenoxy-5-sulfamoylbenzoic acid;butyl 3-amino-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCOC(=O)c1cc(N)c(Oc2ccccc2)c(S(N)(=O)=O)c1.Nc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S.C13H12N2O5S/c1-2-3-9-23-17(20)12-10-14(18)16(15(11-12)25(19,21)22)24-13-7-5-4-6-8-13;14-10-6-8(13(16)17)7-11(21(15,18)19)12(10)20-9-4-2-1-3-5-9/h4-8,10-11H,2-3,9,18H2,1H3,(H2,19,21,22);1-7H,14H2,(H,16,17)(H2,15,18,19) |
| InChIKey | QSXPMYWNDFFRTK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 254.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|