C25H34N2O7S — CID 58033689
propanoyloxymethyl 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 58033689) has the molecular formula C25H34N2O7S and a molecular weight of 506.62 g/mol. Its IUPAC name is propanoyloxymethyl 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | propanoyloxymethyl 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 58033689 |
| Molecular Formula | C25H34N2O7S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | propanoyloxymethyl 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCN(CCCC)c1cc(C(=O)OCOC(=O)CC)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H34N2O7S/c1-4-7-14-27(15-8-5-2)21-16-19(25(29)33-18-32-23(28)6-3)17-22(35(26,30)31)24(21)34-20-12-10-9-11-13-20/h9-13,16-17H,4-8,14-15,18H2,1-3H3,(H2,26,30,31) |
| InChIKey | CPSABTOTBULMBE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|