C25H37N3O4S — CID 58033530
3-(dibutylamino)-N-methyl-4-phenoxy-N-propyl-5-sulfamoylbenzamide (PubChem CID 58033530) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is 3-(dibutylamino)-N-methyl-4-phenoxy-N-propyl-5-sulfamoylbenzamide.
| Compound Name | 3-(dibutylamino)-N-methyl-4-phenoxy-N-propyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 58033530 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 3-(dibutylamino)-N-methyl-4-phenoxy-N-propyl-5-sulfamoylbenzamide |
| SMILES | CCCCN(CCCC)c1cc(C(=O)N(C)CCC)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H37N3O4S/c1-5-8-16-28(17-9-6-2)22-18-20(25(29)27(4)15-7-3)19-23(33(26,30)31)24(22)32-21-13-11-10-12-14-21/h10-14,18-19H,5-9,15-17H2,1-4H3,(H2,26,30,31) |
| InChIKey | GHKZLGONXLEIIL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |