C25H37N3O6S — CID 123675315
3-(dibutylamino)-4-[3-[2-(dimethylamino)ethoxy]phenoxy]-5-sulfamoylbenzoic acid (PubChem CID 123675315) has the molecular formula C25H37N3O6S and a molecular weight of 507.65 g/mol. Its IUPAC name is 3-(dibutylamino)-4-[3-[2-(dimethylamino)ethoxy]phenoxy]-5-sulfamoylbenzoic acid.
| Compound Name | 3-(dibutylamino)-4-[3-[2-(dimethylamino)ethoxy]phenoxy]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 123675315 |
| Molecular Formula | C25H37N3O6S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 3-(dibutylamino)-4-[3-[2-(dimethylamino)ethoxy]phenoxy]-5-sulfamoylbenzoic acid |
| SMILES | CCCCN(CCCC)c1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1cccc(OCCN(C)C)c1 |
| InChI | InChI=1S/C25H37N3O6S/c1-5-7-12-28(13-8-6-2)22-16-19(25(29)30)17-23(35(26,31)32)24(22)34-21-11-9-10-20(18-21)33-15-14-27(3)4/h9-11,16-18H,5-8,12-15H2,1-4H3,(H,29,30)(H2,26,31,32) |
| InChIKey | WKCLMEUEGNBKSD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |