C22H29NO5S — CID 58033539
3-(dibutylamino)-5-methylsulfonyl-4-phenoxybenzoic acid (PubChem CID 58033539) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is 3-(dibutylamino)-5-methylsulfonyl-4-phenoxybenzoic acid.
| Compound Name | 3-(dibutylamino)-5-methylsulfonyl-4-phenoxybenzoic acid |
|---|---|
| PubChem CID | 58033539 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 3-(dibutylamino)-5-methylsulfonyl-4-phenoxybenzoic acid |
| SMILES | CCCCN(CCCC)c1cc(C(=O)O)cc(S(C)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C22H29NO5S/c1-4-6-13-23(14-7-5-2)19-15-17(22(24)25)16-20(29(3,26)27)21(19)28-18-11-9-8-10-12-18/h8-12,15-16H,4-7,13-14H2,1-3H3,(H,24,25) |
| InChIKey | IWKGVQGHNCPDKN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |