C22H27F2NO5S — CID 71526681
3-(dibutylamino)-4-(3,5-difluorophenoxy)-5-methylsulfonylbenzoic acid (PubChem CID 71526681) has the molecular formula C22H27F2NO5S and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-(dibutylamino)-4-(3,5-difluorophenoxy)-5-methylsulfonylbenzoic acid.
| Compound Name | 3-(dibutylamino)-4-(3,5-difluorophenoxy)-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 71526681 |
| Molecular Formula | C22H27F2NO5S |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 3-(dibutylamino)-4-(3,5-difluorophenoxy)-5-methylsulfonylbenzoic acid |
| SMILES | CCCCN(CCCC)c1cc(C(=O)O)cc(S(C)(=O)=O)c1Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H27F2NO5S/c1-4-6-8-25(9-7-5-2)19-10-15(22(26)27)11-20(31(3,28)29)21(19)30-18-13-16(23)12-17(24)14-18/h10-14H,4-9H2,1-3H3,(H,26,27) |
| InChIKey | NIOYSOAOBQDHLH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |