C17H28N2O4S2 — CID 58033617
3-(dibutylamino)-4-ethylsulfanyl-5-sulfamoylbenzoic acid (PubChem CID 58033617) has the molecular formula C17H28N2O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 3-(dibutylamino)-4-ethylsulfanyl-5-sulfamoylbenzoic acid.
| Compound Name | 3-(dibutylamino)-4-ethylsulfanyl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 58033617 |
| Molecular Formula | C17H28N2O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-(dibutylamino)-4-ethylsulfanyl-5-sulfamoylbenzoic acid |
| SMILES | CCCCN(CCCC)c1cc(C(=O)O)cc(S(N)(=O)=O)c1SCC |
| InChI | InChI=1S/C17H28N2O4S2/c1-4-7-9-19(10-8-5-2)14-11-13(17(20)21)12-15(25(18,22)23)16(14)24-6-3/h11-12H,4-10H2,1-3H3,(H,20,21)(H2,18,22,23) |
| InChIKey | NICBTZOXBRYGTJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |