C13H17ClN2O4S — CID 90873558
3-[butyl(ethenyl)amino]-4-chloro-5-sulfamoylbenzoic acid (PubChem CID 90873558) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 3-[butyl(ethenyl)amino]-4-chloro-5-sulfamoylbenzoic acid.
| Compound Name | 3-[butyl(ethenyl)amino]-4-chloro-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 90873558 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-[butyl(ethenyl)amino]-4-chloro-5-sulfamoylbenzoic acid |
| SMILES | C=CN(CCCC)c1cc(C(=O)O)cc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C13H17ClN2O4S/c1-3-5-6-16(4-2)10-7-9(13(17)18)8-11(12(10)14)21(15,19)20/h4,7-8H,2-3,5-6H2,1H3,(H,17,18)(H2,15,19,20) |
| InChIKey | BBEQEJKFJJFPGH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |