C21H28N2O5S — CID 71618345
3-[bis(1,1-dideuteriobutyl)amino]-4-phenoxy-5-sulfamoylbenzoic acid (PubChem CID 71618345) has the molecular formula C21H28N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is 3-[bis(1,1-dideuteriobutyl)amino]-4-phenoxy-5-sulfamoylbenzoic acid.
| Compound Name | 3-[bis(1,1-dideuteriobutyl)amino]-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 71618345 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-[bis(1,1-dideuteriobutyl)amino]-4-phenoxy-5-sulfamoylbenzoic acid |
| SMILES | [2H]C([2H])(CCC)N(c1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1)C([2H])([2H])CCC |
| InChI | InChI=1S/C21H28N2O5S/c1-3-5-12-23(13-6-4-2)18-14-16(21(24)25)15-19(29(22,26)27)20(18)28-17-10-8-7-9-11-17/h7-11,14-15H,3-6,12-13H2,1-2H3,(H,24,25)(H2,22,26,27)/i12D2,13D2 |
| InChIKey | MYCDGAQAFHMODN-IDPVZSQYSA-N |
| XLogP | 4.23 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |