C29H43N3O4S — CID 58033638
N-(cycloheptylmethyl)-3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzamide (PubChem CID 58033638) has the molecular formula C29H43N3O4S and a molecular weight of 529.75 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzamide.
| Compound Name | N-(cycloheptylmethyl)-3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 58033638 |
| Molecular Formula | C29H43N3O4S |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | N-(cycloheptylmethyl)-3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzamide |
| SMILES | CCCCN(CCCC)c1cc(C(=O)NCC2CCCCCC2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C29H43N3O4S/c1-3-5-18-32(19-6-4-2)26-20-24(29(33)31-22-23-14-10-7-8-11-15-23)21-27(37(30,34)35)28(26)36-25-16-12-9-13-17-25/h9,12-13,16-17,20-21,23H,3-8,10-11,14-15,18-19,22H2,1-2H3,(H,31,33)(H2,30,34,35) |
| InChIKey | LLRCJICKESNRJW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |