C29H38N4O4S — CID 123206470
3-(dibutylamino)-N-methyl-4-phenoxy-N-(2-pyridin-3-ylethyl)-5-sulfamoylbenzamide (PubChem CID 123206470) has the molecular formula C29H38N4O4S and a molecular weight of 538.71 g/mol. Its IUPAC name is 3-(dibutylamino)-N-methyl-4-phenoxy-N-(2-pyridin-3-ylethyl)-5-sulfamoylbenzamide.
| Compound Name | 3-(dibutylamino)-N-methyl-4-phenoxy-N-(2-pyridin-3-ylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 123206470 |
| Molecular Formula | C29H38N4O4S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 3-(dibutylamino)-N-methyl-4-phenoxy-N-(2-pyridin-3-ylethyl)-5-sulfamoylbenzamide |
| SMILES | CCCCN(CCCC)c1cc(C(=O)N(C)CCc2cccnc2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C29H38N4O4S/c1-4-6-17-33(18-7-5-2)26-20-24(29(34)32(3)19-15-23-12-11-16-31-22-23)21-27(38(30,35)36)28(26)37-25-13-9-8-10-14-25/h8-14,16,20-22H,4-7,15,17-19H2,1-3H3,(H2,30,35,36) |
| InChIKey | VFAUGUWENVTKOR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |