C25H35N3O6S — CID 58033513
[2-(dimethylamino)-2-oxoethyl] 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 58033513) has the molecular formula C25H35N3O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 58033513 |
| Molecular Formula | C25H35N3O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 3-(dibutylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCN(CCCC)c1cc(C(=O)OCC(=O)N(C)C)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H35N3O6S/c1-5-7-14-28(15-8-6-2)21-16-19(25(30)33-18-23(29)27(3)4)17-22(35(26,31)32)24(21)34-20-12-10-9-11-13-20/h9-13,16-17H,5-8,14-15,18H2,1-4H3,(H2,26,31,32) |
| InChIKey | OKVDADHUCBXYGZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |