C26H29F3N4O3S — CID 171512972
3-(anilinosulfonimidoyl)-5-(butylamino)-4-phenoxy-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 171512972) has the molecular formula C26H29F3N4O3S and a molecular weight of 534.60 g/mol. Its IUPAC name is 3-(anilinosulfonimidoyl)-5-(butylamino)-4-phenoxy-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 3-(anilinosulfonimidoyl)-5-(butylamino)-4-phenoxy-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 171512972 |
| Molecular Formula | C26H29F3N4O3S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 3-(anilinosulfonimidoyl)-5-(butylamino)-4-phenoxy-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | [H]N=S(=O)(Nc1ccccc1)c1cc(C(=O)NCCC(F)(F)F)cc(NCCCC)c1Oc1ccccc1 |
| InChI | InChI=1S/C26H29F3N4O3S/c1-2-3-15-31-22-17-19(25(34)32-16-14-26(27,28)29)18-23(24(22)36-21-12-8-5-9-13-21)37(30,35)33-20-10-6-4-7-11-20/h4-13,17-18,31H,2-3,14-16H2,1H3,(H,32,34)(H2,30,33,35) |
| InChIKey | BYROSINBWWIBRR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|