C25H28F2N4O3S — CID 171512932
3-(anilinosulfonimidoyl)-5-(butylamino)-N-(2,2-difluoroethyl)-4-phenoxybenzamide (PubChem CID 171512932) has the molecular formula C25H28F2N4O3S and a molecular weight of 502.59 g/mol. Its IUPAC name is 3-(anilinosulfonimidoyl)-5-(butylamino)-N-(2,2-difluoroethyl)-4-phenoxybenzamide.
| Compound Name | 3-(anilinosulfonimidoyl)-5-(butylamino)-N-(2,2-difluoroethyl)-4-phenoxybenzamide |
|---|---|
| PubChem CID | 171512932 |
| Molecular Formula | C25H28F2N4O3S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 3-(anilinosulfonimidoyl)-5-(butylamino)-N-(2,2-difluoroethyl)-4-phenoxybenzamide |
| SMILES | [H]N=S(=O)(Nc1ccccc1)c1cc(C(=O)NCC(F)F)cc(NCCCC)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H28F2N4O3S/c1-2-3-14-29-21-15-18(25(32)30-17-23(26)27)16-22(24(21)34-20-12-8-5-9-13-20)35(28,33)31-19-10-6-4-7-11-19/h4-13,15-16,23,29H,2-3,14,17H2,1H3,(H,30,32)(H2,28,31,33) |
| InChIKey | BQQUJHIBEOPYID-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|