C23H29N3O4S — CID 171512971
methyl 3-[(1-bicyclo[1.1.1]pentanylamino)sulfonimidoyl]-5-(butylamino)-4-phenoxybenzoate (PubChem CID 171512971) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is methyl 3-[(1-bicyclo[1.1.1]pentanylamino)sulfonimidoyl]-5-(butylamino)-4-phenoxybenzoate.
| Compound Name | methyl 3-[(1-bicyclo[1.1.1]pentanylamino)sulfonimidoyl]-5-(butylamino)-4-phenoxybenzoate |
|---|---|
| PubChem CID | 171512971 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | methyl 3-[(1-bicyclo[1.1.1]pentanylamino)sulfonimidoyl]-5-(butylamino)-4-phenoxybenzoate |
| SMILES | [H]N=S(=O)(NC12CC(C1)C2)c1cc(C(=O)OC)cc(NCCCC)c1Oc1ccccc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-3-4-10-25-19-11-17(22(27)29-2)12-20(21(19)30-18-8-6-5-7-9-18)31(24,28)26-23-13-16(14-23)15-23/h5-9,11-12,16,25H,3-4,10,13-15H2,1-2H3,(H2,24,26,28) |
| InChIKey | XVARUIDEOYUEOJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|