C23H32N4O5S — CID 171512945
3-(butylamino)-N-methoxy-5-[(oxan-4-ylamino)sulfonimidoyl]-4-phenoxybenzamide (PubChem CID 171512945) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is 3-(butylamino)-N-methoxy-5-[(oxan-4-ylamino)sulfonimidoyl]-4-phenoxybenzamide.
| Compound Name | 3-(butylamino)-N-methoxy-5-[(oxan-4-ylamino)sulfonimidoyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 171512945 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 3-(butylamino)-N-methoxy-5-[(oxan-4-ylamino)sulfonimidoyl]-4-phenoxybenzamide |
| SMILES | [H]N=S(=O)(NC1CCOCC1)c1cc(C(=O)NOC)cc(NCCCC)c1Oc1ccccc1 |
| InChI | InChI=1S/C23H32N4O5S/c1-3-4-12-25-20-15-17(23(28)26-30-2)16-21(22(20)32-19-8-6-5-7-9-19)33(24,29)27-18-10-13-31-14-11-18/h5-9,15-16,18,25H,3-4,10-14H2,1-2H3,(H,26,28)(H2,24,27,29) |
| InChIKey | QMBFXCVJRSBYTN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|