C18H22N2O3S2 — CID 58033476
1-(butylamino)-5-ethanethioyl-2-phenoxy-3-(sulfinoamino)benzene (PubChem CID 58033476) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-(butylamino)-5-ethanethioyl-2-phenoxy-3-(sulfinoamino)benzene.
| Compound Name | 1-(butylamino)-5-ethanethioyl-2-phenoxy-3-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 58033476 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-(butylamino)-5-ethanethioyl-2-phenoxy-3-(sulfinoamino)benzene |
| SMILES | CCCCNc1cc(C(C)=S)cc(NS(=O)O)c1Oc1ccccc1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-3-4-10-19-16-11-14(13(2)24)12-17(20-25(21)22)18(16)23-15-8-6-5-7-9-15/h5-9,11-12,19-20H,3-4,10H2,1-2H3,(H,21,22) |
| InChIKey | ZZNDEFYAJXKBLR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|