C16H18N3O4S- — CID 58033652
4-[2-(butylamino)-4-carboxy-6-(sulfinatoamino)phenyl]pyridine (PubChem CID 58033652) has the molecular formula C16H18N3O4S- and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-[2-(butylamino)-4-carboxy-6-(sulfinatoamino)phenyl]pyridine.
| Compound Name | 4-[2-(butylamino)-4-carboxy-6-(sulfinatoamino)phenyl]pyridine |
|---|---|
| PubChem CID | 58033652 |
| Molecular Formula | C16H18N3O4S- |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-[2-(butylamino)-4-carboxy-6-(sulfinatoamino)phenyl]pyridine |
| SMILES | CCCCNc1cc(C(=O)O)cc(NS(=O)[O-])c1-c1ccncc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-2-3-6-18-13-9-12(16(20)21)10-14(19-24(22)23)15(13)11-4-7-17-8-5-11/h4-5,7-10,18-19H,2-3,6H2,1H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | OTKVJQGTAYOIHT-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|