C8H9N2O4S- — CID 168756210
1-(aminomethyl)-4-carboxy-2-(sulfinatoamino)benzene (PubChem CID 168756210) has the molecular formula C8H9N2O4S- and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-(aminomethyl)-4-carboxy-2-(sulfinatoamino)benzene.
| Compound Name | 1-(aminomethyl)-4-carboxy-2-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 168756210 |
| Molecular Formula | C8H9N2O4S- |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 1-(aminomethyl)-4-carboxy-2-(sulfinatoamino)benzene |
| SMILES | NCc1ccc(C(=O)O)cc1NS(=O)[O-] |
| InChI | InChI=1S/C8H10N2O4S/c9-4-6-2-1-5(8(11)12)3-7(6)10-15(13)14/h1-3,10H,4,9H2,(H,11,12)(H,13,14)/p-1 |
| InChIKey | RIVMQGOOPZAJAM-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|