C17H14N4O5S2 — CID 71013158
6-pyridin-2-yl-N-(2-sulfamoylphenyl)sulfonylpyridine-3-carboxamide (PubChem CID 71013158) has the molecular formula C17H14N4O5S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 6-pyridin-2-yl-N-(2-sulfamoylphenyl)sulfonylpyridine-3-carboxamide.
| Compound Name | 6-pyridin-2-yl-N-(2-sulfamoylphenyl)sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71013158 |
| Molecular Formula | C17H14N4O5S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 6-pyridin-2-yl-N-(2-sulfamoylphenyl)sulfonylpyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccccc1S(=O)(=O)NC(=O)c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C17H14N4O5S2/c18-27(23,24)15-6-1-2-7-16(15)28(25,26)21-17(22)12-8-9-14(20-11-12)13-5-3-4-10-19-13/h1-11H,(H,21,22)(H2,18,23,24) |
| InChIKey | SFGKIHULKGKSLD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |