C20H15N3O2S2 — CID 143805962
N-(2-aminosulfanylphenyl)sulfanyl-4-(1,3-benzoxazol-2-yl)benzamide (PubChem CID 143805962) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(2-aminosulfanylphenyl)sulfanyl-4-(1,3-benzoxazol-2-yl)benzamide.
| Compound Name | N-(2-aminosulfanylphenyl)sulfanyl-4-(1,3-benzoxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 143805962 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(2-aminosulfanylphenyl)sulfanyl-4-(1,3-benzoxazol-2-yl)benzamide |
| SMILES | NSc1ccccc1SNC(=O)c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H15N3O2S2/c21-26-17-7-3-4-8-18(17)27-23-19(24)13-9-11-14(12-10-13)20-22-15-5-1-2-6-16(15)25-20/h1-12H,21H2,(H,23,24) |
| InChIKey | CBUCPLLLFQOYCN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|