C18H20N2O2S — CID 89136186
N-(2-aminophenyl)-3-(3,3-dimethylbut-1-ynyl)benzenesulfonamide (PubChem CID 89136186) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(3,3-dimethylbut-1-ynyl)benzenesulfonamide.
| Compound Name | N-(2-aminophenyl)-3-(3,3-dimethylbut-1-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 89136186 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(2-aminophenyl)-3-(3,3-dimethylbut-1-ynyl)benzenesulfonamide |
| SMILES | CC(C)(C)C#Cc1cccc(S(=O)(=O)Nc2ccccc2N)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-18(2,3)12-11-14-7-6-8-15(13-14)23(21,22)20-17-10-5-4-9-16(17)19/h4-10,13,20H,19H2,1-3H3 |
| InChIKey | NUDBOVYFJRNBBZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|