C15H16F3NO2 — CID 131921968
3-(3-hydroxy-3-methylbut-1-ynyl)-N-(1,1,1-trifluoropropan-2-yl)benzamide (PubChem CID 131921968) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-(3-hydroxy-3-methylbut-1-ynyl)-N-(1,1,1-trifluoropropan-2-yl)benzamide.
| Compound Name | 3-(3-hydroxy-3-methylbut-1-ynyl)-N-(1,1,1-trifluoropropan-2-yl)benzamide |
|---|---|
| PubChem CID | 131921968 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-(3-hydroxy-3-methylbut-1-ynyl)-N-(1,1,1-trifluoropropan-2-yl)benzamide |
| SMILES | CC(NC(=O)c1cccc(C#CC(C)(C)O)c1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO2/c1-10(15(16,17)18)19-13(20)12-6-4-5-11(9-12)7-8-14(2,3)21/h4-6,9-10,21H,1-3H3,(H,19,20) |
| InChIKey | VNIIHZGLWWZNMO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|