C24H27NO — CID 142094338
3-[2-(4-ethylphenyl)ethynyl]benzamide;(2Z,4Z)-3-methylhexa-2,4-diene (PubChem CID 142094338) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[2-(4-ethylphenyl)ethynyl]benzamide;(2Z,4Z)-3-methylhexa-2,4-diene.
| Compound Name | 3-[2-(4-ethylphenyl)ethynyl]benzamide;(2Z,4Z)-3-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 142094338 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-[2-(4-ethylphenyl)ethynyl]benzamide;(2Z,4Z)-3-methylhexa-2,4-diene |
| SMILES | C/C=C\C(C)=C/C.CCc1ccc(C#Cc2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C17H15NO.C7H12/c1-2-13-6-8-14(9-7-13)10-11-15-4-3-5-16(12-15)17(18)19;1-4-6-7(3)5-2/h3-9,12H,2H2,1H3,(H2,18,19);4-6H,1-3H3/b;6-4-,7-5- |
| InChIKey | APLZWWPITXUYSS-WRFMUYTLSA-N |
| XLogP | 5.28 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|