C10H15NO3S — CID 126482957
methyl 5-(3-methoxypropyl)-2-methyl-1,3-thiazole-4-carboxylate (PubChem CID 126482957) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 5-(3-methoxypropyl)-2-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-(3-methoxypropyl)-2-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 126482957 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 5-(3-methoxypropyl)-2-methyl-1,3-thiazole-4-carboxylate |
| SMILES | COCCCc1sc(C)nc1C(=O)OC |
| InChI | InChI=1S/C10H15NO3S/c1-7-11-9(10(12)14-3)8(15-7)5-4-6-13-2/h4-6H2,1-3H3 |
| InChIKey | OEYNLTLWCFHLJI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|