About methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate
methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate (PubChem CID 4275287) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate.
Analyze methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate (CID 4275287) is methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate is CCc1sc(C)nc1C(=O)OC.
What is the InChIKey of methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate?
The InChIKey is CJZOMPVUWWHPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-4-6-7(8(10)11-3)9-5(2)12-6/h4H2,1-3H3.
What are the key properties of methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate?
methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate has a molecular weight of 185.25 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-2-methyl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 4275287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).