C10H15NO4S — CID 141485375
ethyl 5-(2-hydroxy-2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxylate (PubChem CID 141485375) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is ethyl 5-(2-hydroxy-2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(2-hydroxy-2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 141485375 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | ethyl 5-(2-hydroxy-2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C)sc1CC(O)OC |
| InChI | InChI=1S/C10H15NO4S/c1-4-15-10(13)9-7(5-8(12)14-3)16-6(2)11-9/h8,12H,4-5H2,1-3H3 |
| InChIKey | CPVUZSXREBCKNM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|