C9H13NO2S — CID 115422950
methyl 5-methyl-2-propyl-1,3-thiazole-4-carboxylate (PubChem CID 115422950) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is methyl 5-methyl-2-propyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-methyl-2-propyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 115422950 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | methyl 5-methyl-2-propyl-1,3-thiazole-4-carboxylate |
| SMILES | CCCc1nc(C(=O)OC)c(C)s1 |
| InChI | InChI=1S/C9H13NO2S/c1-4-5-7-10-8(6(2)13-7)9(11)12-3/h4-5H2,1-3H3 |
| InChIKey | MRINXXQDDFIBPF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |