C9H13NO2S — CID 115422683
2-butyl-5-methyl-1,3-thiazole-4-carboxylic acid (PubChem CID 115422683) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-butyl-5-methyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-butyl-5-methyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115422683 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-butyl-5-methyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCc1nc(C(=O)O)c(C)s1 |
| InChI | InChI=1S/C9H13NO2S/c1-3-4-5-7-10-8(9(11)12)6(2)13-7/h3-5H2,1-2H3,(H,11,12) |
| InChIKey | VJQMOQOZBUSROQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |