C9H14N2O2S — CID 115422064
5-methyl-2-(propylaminomethyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 115422064) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-methyl-2-(propylaminomethyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-methyl-2-(propylaminomethyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115422064 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 5-methyl-2-(propylaminomethyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCNCc1nc(C(=O)O)c(C)s1 |
| InChI | InChI=1S/C9H14N2O2S/c1-3-4-10-5-7-11-8(9(12)13)6(2)14-7/h10H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | ZJOBKAVKJJKKGP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|