5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid

C8H10N2O3S — CID 117097221

IUPAC5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid
SMILESCCC(=O)Nc1nc(C(=O)O)c(C)s1
InChIInChI=1S/C8H10N2O3S/c1-3-5(11)9-8-10-6(7(12)13)4(2)14-8/h3H2,1-2H3,(H,12,13)(H,9,10,11)
InChIKeyPRXJVIJWOWZBDN-UHFFFAOYSA-N
MW214.25 g/mol
LogP1.50
Rot. Bonds3

About 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid

5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 117097221) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid
PubChem CID117097221
Molecular FormulaC8H10N2O3S
Molecular Weight214.25 g/mol
Exact Mass214.04
IUPAC Name5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid
SMILESCCC(=O)Nc1nc(C(=O)O)c(C)s1
InChIInChI=1S/C8H10N2O3S/c1-3-5(11)9-8-10-6(7(12)13)4(2)14-8/h3H2,1-2H3,(H,12,13)(H,9,10,11)
InChIKeyPRXJVIJWOWZBDN-UHFFFAOYSA-N
XLogP1.50
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.25
LogP ≤ 51.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid (CID 117097221) is 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid is CCC(=O)Nc1nc(C(=O)O)c(C)s1.
What is the InChIKey of 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is PRXJVIJWOWZBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-3-5(11)9-8-10-6(7(12)13)4(2)14-8/h3H2,1-2H3,(H,12,13)(H,9,10,11).
What are the key properties of 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid?
5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 214.25 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 117097221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).