C8H10N2O3S — CID 117097221
5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 117097221) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117097221 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-methyl-2-(propanoylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCC(=O)Nc1nc(C(=O)O)c(C)s1 |
| InChI | InChI=1S/C8H10N2O3S/c1-3-5(11)9-8-10-6(7(12)13)4(2)14-8/h3H2,1-2H3,(H,12,13)(H,9,10,11) |
| InChIKey | PRXJVIJWOWZBDN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |