C10H13ClN2O3S — CID 167910752
methyl 2-[2-[(2-chloroacetyl)amino]ethyl]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 167910752) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is methyl 2-[2-[(2-chloroacetyl)amino]ethyl]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-[(2-chloroacetyl)amino]ethyl]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 167910752 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | methyl 2-[2-[(2-chloroacetyl)amino]ethyl]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(CCNC(=O)CCl)sc1C |
| InChI | InChI=1S/C10H13ClN2O3S/c1-6-9(10(15)16-2)13-8(17-6)3-4-12-7(14)5-11/h3-5H2,1-2H3,(H,12,14) |
| InChIKey | SRAOLUDHRVMKRZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|