C9H14N4O3S — CID 83117228
methyl 2-[2-(carbamoylamino)ethylamino]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 83117228) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is methyl 2-[2-(carbamoylamino)ethylamino]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-(carbamoylamino)ethylamino]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 83117228 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methyl 2-[2-(carbamoylamino)ethylamino]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NCCNC(N)=O)sc1C |
| InChI | InChI=1S/C9H14N4O3S/c1-5-6(7(14)16-2)13-9(17-5)12-4-3-11-8(10)15/h3-4H2,1-2H3,(H,12,13)(H3,10,11,15) |
| InChIKey | JSJIYWMBQYFJAX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|