C11H15N3O4S — CID 106697022
methyl 2-(2-acetamidoethylamino)-5-acetyl-1,3-thiazole-4-carboxylate (PubChem CID 106697022) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 2-(2-acetamidoethylamino)-5-acetyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(2-acetamidoethylamino)-5-acetyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106697022 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl 2-(2-acetamidoethylamino)-5-acetyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NCCNC(C)=O)sc1C(C)=O |
| InChI | InChI=1S/C11H15N3O4S/c1-6(15)9-8(10(17)18-3)14-11(19-9)13-5-4-12-7(2)16/h4-5H2,1-3H3,(H,12,16)(H,13,14) |
| InChIKey | LXGPBITYRYADEO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|