C12H11BrN2O2S — CID 53271409
ethyl 2-amino-5-(3-bromophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 53271409) has the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. Its IUPAC name is ethyl 2-amino-5-(3-bromophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-amino-5-(3-bromophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 53271409 |
| Molecular Formula | C12H11BrN2O2S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | ethyl 2-amino-5-(3-bromophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N)sc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C12H11BrN2O2S/c1-2-17-11(16)9-10(18-12(14)15-9)7-4-3-5-8(13)6-7/h3-6H,2H2,1H3,(H2,14,15) |
| InChIKey | TXDKJTFDFLZSRS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |