C13H11NO3S — CID 59291290
ethyl 2-formyl-5-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 59291290) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is ethyl 2-formyl-5-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-formyl-5-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59291290 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | ethyl 2-formyl-5-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C=O)sc1-c1ccccc1 |
| InChI | InChI=1S/C13H11NO3S/c1-2-17-13(16)11-12(18-10(8-15)14-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | VXJGEGBFHXZHLA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|