C6H9FN2S — CID 83853616
5-(1-fluoroethyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 83853616) has the molecular formula C6H9FN2S and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-(1-fluoroethyl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-(1-fluoroethyl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83853616 |
| Molecular Formula | C6H9FN2S |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 5-(1-fluoroethyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1C(C)F |
| InChI | InChI=1S/C6H9FN2S/c1-3(7)5-4(2)9-6(8)10-5/h3H,1-2H3,(H2,8,9) |
| InChIKey | ABQFISDDWMLAOO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |