C7H6F6N2S — CID 130154004
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 130154004) has the molecular formula C7H6F6N2S and a molecular weight of 264.19 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130154004 |
| Molecular Formula | C7H6F6N2S |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6N2S/c1-2-3(16-5(14)15-2)4(6(8,9)10)7(11,12)13/h4H,1H3,(H2,14,15) |
| InChIKey | DJXCKBQATLTPSO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |