C5H8BrN2S- — CID 21234862
4,5-dimethyl-1,3-thiazol-2-amine bromide (PubChem CID 21234862) has the molecular formula C5H8BrN2S- and a molecular weight of 208.10 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-thiazol-2-amine bromide.
| Compound Name | 4,5-dimethyl-1,3-thiazol-2-amine bromide |
|---|---|
| PubChem CID | 21234862 |
| Molecular Formula | C5H8BrN2S- |
| Molecular Weight | 208.10 g/mol |
| Exact Mass | 206.96 |
| IUPAC Name | 4,5-dimethyl-1,3-thiazol-2-amine bromide |
| SMILES | Cc1nc(N)sc1C.[Br-] |
| InChI | InChI=1S/C5H8N2S.BrH/c1-3-4(2)8-5(6)7-3;/h1-2H3,(H2,6,7);1H/p-1 |
| InChIKey | CATCJRCKBGAMKK-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.10 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |