C8H14N2S — CID 177047215
ethane;5-ethenyl-4-methyl-1,3-thiazol-2-amine (PubChem CID 177047215) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is ethane;5-ethenyl-4-methyl-1,3-thiazol-2-amine.
| Compound Name | ethane;5-ethenyl-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 177047215 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | ethane;5-ethenyl-4-methyl-1,3-thiazol-2-amine |
| SMILES | C=Cc1sc(N)nc1C.CC |
| InChI | InChI=1S/C6H8N2S.C2H6/c1-3-5-4(2)8-6(7)9-5;1-2/h3H,1H2,2H3,(H2,7,8);1-2H3 |
| InChIKey | NNXGSQIHULEJGD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |