C10H19NOS — CID 142103323
2,4-dimethyl-1,3-thiazole-5-carbaldehyde;ethane (PubChem CID 142103323) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazole-5-carbaldehyde;ethane.
| Compound Name | 2,4-dimethyl-1,3-thiazole-5-carbaldehyde;ethane |
|---|---|
| PubChem CID | 142103323 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,4-dimethyl-1,3-thiazole-5-carbaldehyde;ethane |
| SMILES | CC.CC.Cc1nc(C)c(C=O)s1 |
| InChI | InChI=1S/C6H7NOS.2C2H6/c1-4-6(3-8)9-5(2)7-4;2*1-2/h3H,1-2H3;2*1-2H3 |
| InChIKey | MCUIEZSBAMLATG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|