C9H6ClNOS2 — CID 82130310
4-(5-chlorothiophen-2-yl)-2-methyl-1,3-thiazole-5-carbaldehyde (PubChem CID 82130310) has the molecular formula C9H6ClNOS2 and a molecular weight of 243.74 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-2-methyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-(5-chlorothiophen-2-yl)-2-methyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 82130310 |
| Molecular Formula | C9H6ClNOS2 |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-2-methyl-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(-c2ccc(Cl)s2)c(C=O)s1 |
| InChI | InChI=1S/C9H6ClNOS2/c1-5-11-9(7(4-12)13-5)6-2-3-8(10)14-6/h2-4H,1H3 |
| InChIKey | MULHPEAOFAOGMG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|