C10H9ClN2OS2 — CID 94697789
4-(5-chlorothiophen-2-yl)-2-(dimethylamino)-1,3-thiazole-5-carbaldehyde (PubChem CID 94697789) has the molecular formula C10H9ClN2OS2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-2-(dimethylamino)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-(5-chlorothiophen-2-yl)-2-(dimethylamino)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 94697789 |
| Molecular Formula | C10H9ClN2OS2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-2-(dimethylamino)-1,3-thiazole-5-carbaldehyde |
| SMILES | CN(C)c1nc(-c2ccc(Cl)s2)c(C=O)s1 |
| InChI | InChI=1S/C10H9ClN2OS2/c1-13(2)10-12-9(7(5-14)16-10)6-3-4-8(11)15-6/h3-5H,1-2H3 |
| InChIKey | FQMFJOYEKJVREJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|