C9H12N2O3S2 — CID 62764717
2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methyl-1,3-thiazole-5-carbaldehyde (PubChem CID 62764717) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62764717 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methyl-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(N2CCS(=O)(=O)CC2)sc1C=O |
| InChI | InChI=1S/C9H12N2O3S2/c1-7-8(6-12)15-9(10-7)11-2-4-16(13,14)5-3-11/h6H,2-5H2,1H3 |
| InChIKey | SKZLHWDDXMKZNP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|